CAS 78495-65-5 appears in our catalog under these names: 2–(2–Fluoro–3,4–dimethoxyphenyl)acetic acid, 2-(2-Fluoro-3,4-dimethoxyphenyl)acetic acid 97%, 2-(2-Fluoro-3,4-dimethoxyphenyl)acetic acid, 97%, 97%, 2-(2-Fluoro-3,4-dimethoxyphenyl)acetic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-(2-fluoro-3,4-dimethoxyphenyl)acetic acid (CAS 78495-65-5) is a chemical compound with the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. IUPAC name: 2-(2-fluoro-3,4-dimethoxyphenyl)acetic acid. InChIKey: RAXDCPIEIZUGRH-UHFFFAOYSA-N.
| Molecular formula | C10H11FO4 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | 2-(2-fluoro-3,4-dimethoxyphenyl)acetic acid |
| InChIKey | RAXDCPIEIZUGRH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CC(=O)O)F)OC |
Computed by PubChem (NCBI)