CAS 651734-58-6 appears in our catalog under these names: Methyl 2-fluoro-3,5-dimethoxybenzoate, 95%, Methyl 2–fluoro–3,5–dimethoxybenzoate, Methyl 2-fluoro-3,5-dimethoxybenzoate 95%, Methyl 2-fluoro-3,5-dimethoxybenzoate, 98%, 98%, Methyl 2-fluoro-3,5-dimethoxybenzoate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
Methyl 2-fluoro-3,5-dimethoxybenzoate (CAS 651734-58-6) is a chemical compound with the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. IUPAC name: methyl 2-fluoro-3,5-dimethoxybenzoate. InChIKey: IALAUVYODBSDEV-UHFFFAOYSA-N.
| Molecular formula | C10H11FO4 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | methyl 2-fluoro-3,5-dimethoxybenzoate |
| InChIKey | IALAUVYODBSDEV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)F)C(=O)OC |
Computed by PubChem (NCBI)