CAS 1895436-51-7 appears in our catalog under these names: 5-Fluoro-3,4-dimethoxy-2-methylbenzoic acid, 98%, 5-Fluoro-3,4-dimethoxy-2-methylbenzoic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
5-fluoro-3,4-dimethoxy-2-methylbenzoic acid (CAS 1895436-51-7) is a chemical compound with the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. IUPAC name: 5-fluoro-3,4-dimethoxy-2-methylbenzoic acid. InChIKey: RAFLRLQJCIONAV-UHFFFAOYSA-N.
| Molecular formula | C10H11FO4 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | 5-fluoro-3,4-dimethoxy-2-methylbenzoic acid |
| InChIKey | RAFLRLQJCIONAV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1C(=O)O)F)OC)OC |
Computed by PubChem (NCBI)