CAS 1512074-73-5 appears in our catalog under these names: 3-(3-Bromophenyl)cyclobutane-1-carboxylic acid, 98%, 3-(3-Bromophenyl)cyclobutane-1-carboxylic acid, 97%, 97%, 3-(3-bromophenyl)cyclobutanecarboxylic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg, 5g.
3-(3-bromophenyl)cyclobutane-1-carboxylic acid (CAS 1512074-73-5) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 3-(3-bromophenyl)cyclobutane-1-carboxylic acid. InChIKey: IZFBCJNREVFPOJ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 3-(3-bromophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | IZFBCJNREVFPOJ-UHFFFAOYSA-N |
| SMILES | C1C(CC1C(=O)O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)