Products 1512184-59-6
CAS 1512184-59-6 is the registry number for 3-(4-Fluorophenyl)-5,6,7,8-tetrahydro-(1,2,4)triazolo(4,3-a)pyridine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (CAS 1512184-59-6) is a chemical compound with the molecular formula C13H12FN3O2 and a molecular weight of 261.25 g/mol. IUPAC name: 3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid. InChIKey: WQOKHMRIBWKRDT-UHFFFAOYSA-N.
| Molecular formula | C13H12FN3O2 |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
| InChIKey | WQOKHMRIBWKRDT-UHFFFAOYSA-N |
| SMILES | C1CC2=NN=C(N2CC1C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)