CAS 151224-50-9 is the registry number for 3,3'-Diacetyl-cis-azobenzene. Offered by: TRC. Available pack sizes: 50mg.
1-[3-[(3-acetylphenyl)diazenyl]phenyl]ethanone (CAS 151224-50-9) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 1-[3-[(3-acetylphenyl)diazenyl]phenyl]ethanone. InChIKey: DOIWHHWUHOVBBP-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 1-[3-[(3-acetylphenyl)diazenyl]phenyl]ethanone |
| InChIKey | DOIWHHWUHOVBBP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)N=NC2=CC=CC(=C2)C(=O)C |
Computed by PubChem (NCBI)