CAS 1512448-95-1 appears in our catalog under these names: 2-(tert-Butyl)-(1,2,4)triazolo(1,5-a)pyridin-6-amine, 98%, 2-(tert-Butyl)-[1,2,4]triazolo[1,5-a]pyridin-6-amine, >95.0%(qNMR), 2-tert-Butyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine, 95.0%, 95.0%. Offered by: AmBeed, TCI, Chemat. Available pack sizes: 1g, 100mg.
2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine (CAS 1512448-95-1) is a chemical compound with the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. IUPAC name: 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine. InChIKey: AQNHBJPIPIRBKT-UHFFFAOYSA-N.
| Molecular formula | C10H14N4 |
|---|---|
| Molecular weight | 190.25 g/mol |
| IUPAC name | 2-tert-butyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| InChIKey | AQNHBJPIPIRBKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN2C=C(C=CC2=N1)N |
Computed by PubChem (NCBI)