CAS 951626-63-4 is the registry number for 6-tert-Butyl-1h-pyrazolo[3,4-b]pyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-tert-butyl-2H-pyrazolo[3,4-b]pyridin-3-amine (CAS 951626-63-4) is a chemical compound with the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. IUPAC name: 6-tert-butyl-2H-pyrazolo[3,4-b]pyridin-3-amine. InChIKey: RJHFLZIAJNHHMD-UHFFFAOYSA-N.
| Molecular formula | C10H14N4 |
|---|---|
| Molecular weight | 190.25 g/mol |
| IUPAC name | 6-tert-butyl-2H-pyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | RJHFLZIAJNHHMD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=NNC(=C2C=C1)N |
Computed by PubChem (NCBI)