CAS 4054-67-5 appears in our catalog under these names: 3,3',5,5'–Tetramethyl–1H,1'H–4,4'–bipyrazole, 3,3',5,5'-Tetramethyl-1H,1'H-4,4'-bipyrazole, 98%, 98%, 3,3',5,5'-Tetramethyl-1H,1'H-4,4'-bipyrazole, 97%, 3,3',5,5'-Tetramethyl-1H,1'H-4,4'-bipyrazole, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
4-(3,5-dimethyl-1H-pyrazol-4-yl)-3,5-dimethyl-1H-pyrazole (CAS 4054-67-5) is a chemical compound with the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. IUPAC name: 4-(3,5-dimethyl-1H-pyrazol-4-yl)-3,5-dimethyl-1H-pyrazole. InChIKey: AZVPUVHTLAXDBK-UHFFFAOYSA-N.
| Molecular formula | C10H14N4 |
|---|---|
| Molecular weight | 190.25 g/mol |
| IUPAC name | 4-(3,5-dimethyl-1H-pyrazol-4-yl)-3,5-dimethyl-1H-pyrazole |
| InChIKey | AZVPUVHTLAXDBK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C2=C(NN=C2C)C |
Computed by PubChem (NCBI)