Products 2166952-93-6
CAS 2166952-93-6 is the registry number for 3-(Bicyclo[1.1.1]pentan-1-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1-bicyclo[1.1.1]pentanyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (CAS 2166952-93-6) is a chemical compound with the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. IUPAC name: 3-(1-bicyclo[1.1.1]pentanyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine. InChIKey: JNCDQUOSELXPGK-UHFFFAOYSA-N.
| Molecular formula | C10H14N4 |
|---|---|
| Molecular weight | 190.25 g/mol |
| IUPAC name | 3-(1-bicyclo[1.1.1]pentanyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| InChIKey | JNCDQUOSELXPGK-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NN=C2C34CC(C3)C4)CN1 |
Computed by PubChem (NCBI)