Products 1512484-61-5

CAS 1512484-61-5 is the registry number for tert-Butyl 3-cyclobutyl-2-methyl-3-oxopropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-cyclobutyl-2-methyl-3-oxopropanoate (CAS 1512484-61-5) is a chemical compound with the molecular formula C12H20O3 and a molecular weight of 212.28 g/mol. IUPAC name: tert-butyl 3-cyclobutyl-2-methyl-3-oxopropanoate. InChIKey: RLDVIWOAJOCRFE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O3
Molecular weight212.28 g/mol
IUPAC nametert-butyl 3-cyclobutyl-2-methyl-3-oxopropanoate
InChIKeyRLDVIWOAJOCRFE-UHFFFAOYSA-N
SMILESCC(C(=O)C1CCC1)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)