Products 15128-50-4
CAS 15128-50-4 appears in our catalog under these names: Dibenzo[b,e]oxepine-6,11-dione 91+%, Dibenzo[b,e]oxepine-6,11-dione, 91+%, 91+%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Benzo[c][1]benzoxepine-6,11-dione (CAS 15128-50-4) is a chemical compound with the molecular formula C14H8O3 and a molecular weight of 224.21 g/mol. IUPAC name: benzo[c][1]benzoxepine-6,11-dione. InChIKey: YOKBSFKAGIUKJN-UHFFFAOYSA-N.
| Molecular formula | C14H8O3 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | benzo[c][1]benzoxepine-6,11-dione |
| InChIKey | YOKBSFKAGIUKJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3OC2=O |
Computed by PubChem (NCBI)
Synonyms:
Dibenzo[b,E]oxepine-6,11-dione, Dibenz[b,e]oxepin-6,11-dione, Dibenz[b,e]oxepine-6,11-dione, Benzoic acid, o-salicyloyl-, .epsilon.-lactone, .epsilon.-Lactone of 2-carboxy-2'-hydroxybenzophenone, Dibenz(b,e)oxepin-6,11-dione, benzo[c][1]benzoxepine-6,11-dione, Dibenz[b,11-dione, NCIOpen2_004443, Benzoic acid, .epsilon.-lactone