Products 1513091-25-2
CAS 1513091-25-2 is the registry number for 2-(3-Chlorophenyl)-2H,4H,5H,6H-cyclopenta(C)pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-chlorophenyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine (CAS 1513091-25-2) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 2-(3-chlorophenyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine. InChIKey: VSAXQROHLQTPLY-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine |
| InChIKey | VSAXQROHLQTPLY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(N(N=C2C1)C3=CC(=CC=C3)Cl)N |
Computed by PubChem (NCBI)