Products 1513127-41-7
CAS 1513127-41-7 is the registry number for 1,5-Dimethyl-3,4-dihydroquinoxalin-2(1H)-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,5-dimethyl-3,4-dihydroquinoxalin-2-one (CAS 1513127-41-7) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1,5-dimethyl-3,4-dihydroquinoxalin-2-one. InChIKey: LVLJUQLSOCIMIR-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1,5-dimethyl-3,4-dihydroquinoxalin-2-one |
| InChIKey | LVLJUQLSOCIMIR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)N(C(=O)CN2)C |
Computed by PubChem (NCBI)