Products 151410-32-1
CAS 151410-32-1 is the registry number for Xinjiachalcone A. Offered by: MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg.
(E)-1-(4-hydroxyphenyl)-3-[2-methoxy-4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one (CAS 151410-32-1) is a chemical compound with the molecular formula C21H22O4 and a molecular weight of 338.4 g/mol. IUPAC name: (E)-1-(4-hydroxyphenyl)-3-[2-methoxy-4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one. InChIKey: SUYNBFRQRFEKGN-YRNVUSSQSA-N.
| Molecular formula | C21H22O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | (E)-1-(4-hydroxyphenyl)-3-[2-methoxy-4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one |
| InChIKey | SUYNBFRQRFEKGN-YRNVUSSQSA-N |
| SMILES | CC(=CCOC1=CC(=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)O)OC)C |
Computed by PubChem (NCBI)
Synonyms:
Xinjiachalcone A, orb1989642