Products 1514244-63-3
CAS 1514244-63-3 is the registry number for 1-(2,4-Dichlorophenyl)-2-methoxyethan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,4-dichlorophenyl)-2-methoxyethanol (CAS 1514244-63-3) is a chemical compound with the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-2-methoxyethanol. InChIKey: QWHUNIYKFAQICU-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O2 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-2-methoxyethanol |
| InChIKey | QWHUNIYKFAQICU-UHFFFAOYSA-N |
| SMILES | COCC(C1=C(C=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)