CAS 151434-95-6 is the registry number for rac-N-((1R,2R)-2-Aminocyclohexyl)benzamide hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
N-[(1R,2R)-2-aminocyclohexyl]benzamide;hydrochloride (CAS 151434-95-6) is a chemical compound with the molecular formula C13H19ClN2O and a molecular weight of 254.75 g/mol. IUPAC name: N-[(1R,2R)-2-aminocyclohexyl]benzamide;hydrochloride. InChIKey: MYYLVQFXWRFWFZ-MNMPKAIFSA-N.
| Molecular formula | C13H19ClN2O |
|---|---|
| Molecular weight | 254.75 g/mol |
| IUPAC name | N-[(1R,2R)-2-aminocyclohexyl]benzamide;hydrochloride |
| InChIKey | MYYLVQFXWRFWFZ-MNMPKAIFSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)NC(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)