Products 1515330-45-6
CAS 1515330-45-6 is the registry number for ethyl 2-(5-cyano-2-fluorophenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(5-cyano-2-fluorophenyl)-2-oxoacetate (CAS 1515330-45-6) is a chemical compound with the molecular formula C11H8FNO3 and a molecular weight of 221.18 g/mol. IUPAC name: ethyl 2-(5-cyano-2-fluorophenyl)-2-oxoacetate. InChIKey: OYHROASDVCKLJV-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO3 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | ethyl 2-(5-cyano-2-fluorophenyl)-2-oxoacetate |
| InChIKey | OYHROASDVCKLJV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=CC(=C1)C#N)F |
Computed by PubChem (NCBI)