Products 151539-49-0

CAS 151539-49-0 is the registry number for (E)-3-(3-Bromo-4-methoxyphenyl)acrylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

(E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoic acid (CAS 151539-49-0) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoic acid. InChIKey: VTHCKJFXUYPZAO-HWKANZROSA-N.

Identity
Molecular formulaC10H9BrO3
Molecular weight257.08 g/mol
IUPAC name(E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoic acid
InChIKeyVTHCKJFXUYPZAO-HWKANZROSA-N
SMILESCOC1=C(C=C(C=C1)/C=C/C(=O)O)Br

Computed by PubChem (NCBI)