CAS 1516390-48-9 is the registry number for 6-Chlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-one (CAS 1516390-48-9) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: 6-chlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-one. InChIKey: YKQJIGBMRQNKJR-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | 6-chlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-one |
| InChIKey | YKQJIGBMRQNKJR-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(=O)NC3=C(N2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)