Products 1516852-05-3

CAS 1516852-05-3 is the registry number for 4,4-Dimethylpentane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4,4-dimethylpentane-1-sulfonyl chloride (CAS 1516852-05-3) is a chemical compound with the molecular formula C7H15ClO2S and a molecular weight of 198.71 g/mol. IUPAC name: 4,4-dimethylpentane-1-sulfonyl chloride. InChIKey: DEVIWAYOANATKM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15ClO2S
Molecular weight198.71 g/mol
IUPAC name4,4-dimethylpentane-1-sulfonyl chloride
InChIKeyDEVIWAYOANATKM-UHFFFAOYSA-N
SMILESCC(C)(C)CCCS(=O)(=O)Cl

Computed by PubChem (NCBI)