Products 1517337-89-1

CAS 1517337-89-1 is the registry number for 6-((Tetrahydro-2H-pyran-4-yl)methoxy)pyrazine-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

6-(oxan-4-ylmethoxy)pyrazine-2-carboxylic acid (CAS 1517337-89-1) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: 6-(oxan-4-ylmethoxy)pyrazine-2-carboxylic acid. InChIKey: OBJHPNHVPUCKNX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14N2O4
Molecular weight238.24 g/mol
IUPAC name6-(oxan-4-ylmethoxy)pyrazine-2-carboxylic acid
InChIKeyOBJHPNHVPUCKNX-UHFFFAOYSA-N
SMILESC1COCCC1COC2=NC(=CN=C2)C(=O)O

Computed by PubChem (NCBI)