Products 1518095-22-1
CAS 1518095-22-1 is the registry number for 2-N-((2-Chlorophenyl)methyl)-1,3-benzoxazole-2,6-diamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-N-[(2-chlorophenyl)methyl]-1,3-benzoxazole-2,6-diamine (CAS 1518095-22-1) is a chemical compound with the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. IUPAC name: 2-N-[(2-chlorophenyl)methyl]-1,3-benzoxazole-2,6-diamine. InChIKey: OOMAEYFDQQXDEZ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3O |
|---|---|
| Molecular weight | 273.72 g/mol |
| IUPAC name | 2-N-[(2-chlorophenyl)methyl]-1,3-benzoxazole-2,6-diamine |
| InChIKey | OOMAEYFDQQXDEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=NC3=C(O2)C=C(C=C3)N)Cl |
Computed by PubChem (NCBI)