CAS 151910-11-1 is the registry number for (1S,2R)-1-((tert-Butoxycarbonyl)amino)-2-phenylcyclopropanecarboxylic acid, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 250mg.
Trans-(1S,2R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylcyclopropane-1-carboxylic acid (CAS 151910-11-1) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: trans-(1S,2R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylcyclopropane-1-carboxylic acid. InChIKey: VMOVYASDUSWBOL-ABAIWWIYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | trans-(1S,2R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylcyclopropane-1-carboxylic acid |
| InChIKey | VMOVYASDUSWBOL-ABAIWWIYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@]1(C[C@@H]1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)