Products 1519350-68-5

CAS 1519350-68-5 is the registry number for 2-(4-(Cyclopent-3-ene-1-carbonyl)morpholin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[4-(cyclopent-3-ene-1-carbonyl)morpholin-2-yl]acetic acid (CAS 1519350-68-5) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: 2-[4-(cyclopent-3-ene-1-carbonyl)morpholin-2-yl]acetic acid. InChIKey: VZKIZYQNUAQIQU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO4
Molecular weight239.27 g/mol
IUPAC name2-[4-(cyclopent-3-ene-1-carbonyl)morpholin-2-yl]acetic acid
InChIKeyVZKIZYQNUAQIQU-UHFFFAOYSA-N
SMILESC1COC(CN1C(=O)C2CC=CC2)CC(=O)O

Computed by PubChem (NCBI)