Products 1519398-17-4
CAS 1519398-17-4 appears in our catalog under these names: 8-Bromo-3,6-dimethyl-[1,2,4]triazolo[4,3-a]pyridine, 98%, 8-Bromo-3,6-dimethyl-(1,2,4)triazolo(4,3-a)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
8-bromo-3,6-dimethyl-[1,2,4]triazolo[4,3-a]pyridine (CAS 1519398-17-4) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 8-bromo-3,6-dimethyl-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: OBXKBZNAXGTEPY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 8-bromo-3,6-dimethyl-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | OBXKBZNAXGTEPY-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NN=C2C(=C1)Br)C |
Computed by PubChem (NCBI)