CAS 1519514-63-6 is the registry number for CRBN ligand-191. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-amino-N-(2,6-dioxopiperidin-3-yl)cyclobutane-1-carboxamide (CAS 1519514-63-6) is a chemical compound with the molecular formula C10H15N3O3 and a molecular weight of 225.24 g/mol. IUPAC name: 1-amino-N-(2,6-dioxopiperidin-3-yl)cyclobutane-1-carboxamide. InChIKey: RKUNMAFHFDTYKR-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O3 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 1-amino-N-(2,6-dioxopiperidin-3-yl)cyclobutane-1-carboxamide |
| InChIKey | RKUNMAFHFDTYKR-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C(=O)NC2CCC(=O)NC2=O)N |
Computed by PubChem (NCBI)