CAS 15196-02-8 is the registry number for Z-L-Phe-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
Benzyl N-[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamate (CAS 15196-02-8) is a chemical compound with the molecular formula C18H17N3O3 and a molecular weight of 323.3 g/mol. IUPAC name: benzyl N-[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamate. InChIKey: WLGLEWHRLFWXLX-INIZCTEOSA-N.
| Molecular formula | C18H17N3O3 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | benzyl N-[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamate |
| InChIKey | WLGLEWHRLFWXLX-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)C=[N+]=[N-])NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)