Products 942655-44-9
CAS 942655-44-9 appears in our catalog under these names: Jk-p3, 95%, JK–P3, JK-P3/ 100%, JK-P3, JK-P3, >98.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, TCI. Available pack sizes: 25mg, 5mg, 100mg, 10mg, 250mg, 2mg, 50mg, 200mg.
3,4-dimethoxy-N-(5-phenyl-1H-pyrazol-3-yl)benzamide (CAS 942655-44-9) is a chemical compound with the molecular formula C18H17N3O3 and a molecular weight of 323.3 g/mol. IUPAC name: 3,4-dimethoxy-N-(5-phenyl-1H-pyrazol-3-yl)benzamide. InChIKey: QAZJUVDICQNITG-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O3 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 3,4-dimethoxy-N-(5-phenyl-1H-pyrazol-3-yl)benzamide |
| InChIKey | QAZJUVDICQNITG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)NC2=NNC(=C2)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)