CAS 1610377-08-6 is the registry number for 4-[(1-Oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2(1h)-yl)methyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-[(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2-yl)methyl]benzoic acid (CAS 1610377-08-6) is a chemical compound with the molecular formula C18H17N3O3 and a molecular weight of 323.3 g/mol. IUPAC name: 4-[(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2-yl)methyl]benzoic acid. InChIKey: HRRPZUZOKALSOI-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O3 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 4-[(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2-yl)methyl]benzoic acid |
| InChIKey | HRRPZUZOKALSOI-UHFFFAOYSA-N |
| SMILES | C1CCC2=NN3C=CN(C(=O)C3=C2C1)CC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)