CAS 350997-66-9 appears in our catalog under these names: 2-(3,4-Dimethoxyphenyl)quinoline-4-carbohydrazide, 95%, 2-(3,4-Dimethoxy-phenyl)-quinoline-4-carboxylic acid hydrazide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
2-(3,4-dimethoxyphenyl)quinoline-4-carbohydrazide (CAS 350997-66-9) is a chemical compound with the molecular formula C18H17N3O3 and a molecular weight of 323.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)quinoline-4-carbohydrazide. InChIKey: YKMWFORHWALOOV-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O3 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)quinoline-4-carbohydrazide |
| InChIKey | YKMWFORHWALOOV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)NN)OC |
Computed by PubChem (NCBI)