CAS 1519742-55-2 is the registry number for 6-{(1,2,4)Triazolo(4,3-a)pyridin-3-yl}pyridin-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyridin-2-amine (CAS 1519742-55-2) is a chemical compound with the molecular formula C11H9N5 and a molecular weight of 211.22 g/mol. IUPAC name: 6-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyridin-2-amine. InChIKey: YUOREWVGDIFVMU-UHFFFAOYSA-N.
| Molecular formula | C11H9N5 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 6-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyridin-2-amine |
| InChIKey | YUOREWVGDIFVMU-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=C(N2C=C1)C3=NC(=CC=C3)N |
Computed by PubChem (NCBI)