Products 1519859-51-8
CAS 1519859-51-8 is the registry number for 1-(3-Aminophenyl)-4-methyl-2,3-dihydro-1H-imidazol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3-aminophenyl)-5-methyl-1H-imidazol-2-one (CAS 1519859-51-8) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 3-(3-aminophenyl)-5-methyl-1H-imidazol-2-one. InChIKey: URGWDEQVHMETIK-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-(3-aminophenyl)-5-methyl-1H-imidazol-2-one |
| InChIKey | URGWDEQVHMETIK-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=O)N1)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)