CAS 15206-33-4 is the registry number for 8-Amino-7-chloro-(1,2,4)triazolo(4,3-c)pyrimidin-3-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-amino-7-chloro-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (CAS 15206-33-4) is a chemical compound with the molecular formula C5H4ClN5O and a molecular weight of 185.57 g/mol. IUPAC name: 8-amino-7-chloro-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one. InChIKey: XYZPQHDOYCOWBK-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN5O |
|---|---|
| Molecular weight | 185.57 g/mol |
| IUPAC name | 8-amino-7-chloro-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| InChIKey | XYZPQHDOYCOWBK-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C2=NNC(=O)N21)N)Cl |
Computed by PubChem (NCBI)