CAS 953751-07-0 is the registry number for 5-(Chloromethyl)-3-(1H-1,2,4-triazol-3-yl)-1,2,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(chloromethyl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole (CAS 953751-07-0) is a chemical compound with the molecular formula C5H4ClN5O and a molecular weight of 185.57 g/mol. IUPAC name: 5-(chloromethyl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole. InChIKey: MDUFSXNYEUKOQE-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN5O |
|---|---|
| Molecular weight | 185.57 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole |
| InChIKey | MDUFSXNYEUKOQE-UHFFFAOYSA-N |
| SMILES | C1=NNC(=N1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)