Products 2260885-56-9
CAS 2260885-56-9 is the registry number for 8-Chloro-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one (CAS 2260885-56-9) is a chemical compound with the molecular formula C5H4ClN5O and a molecular weight of 185.57 g/mol. IUPAC name: 8-chloro-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one. InChIKey: WUDTXRDBMSKXEU-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN5O |
|---|---|
| Molecular weight | 185.57 g/mol |
| IUPAC name | 8-chloro-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one |
| InChIKey | WUDTXRDBMSKXEU-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N2C=NC(=C2N=N1)Cl |
Computed by PubChem (NCBI)