CAS 27604-21-3 is the registry number for 5-Amino-6-chloro-4,7-dihydro-2H-imidazo[4,5-b]pyrazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-5-chloro-1,3-dihydroimidazo[4,5-b]pyrazin-2-one (CAS 27604-21-3) is a chemical compound with the molecular formula C5H4ClN5O and a molecular weight of 185.57 g/mol. IUPAC name: 6-amino-5-chloro-1,3-dihydroimidazo[4,5-b]pyrazin-2-one. InChIKey: YJAWUVTYYAXOQY-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN5O |
|---|---|
| Molecular weight | 185.57 g/mol |
| IUPAC name | 6-amino-5-chloro-1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
| InChIKey | YJAWUVTYYAXOQY-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C2C(=N1)NC(=O)N2)Cl)N |
Computed by PubChem (NCBI)