Products 152088-13-6
CAS 152088-13-6 appears in our catalog under these names: 5-Chloro-1,3-dimethyl-1h-indole-2-carboxylic acid, 95%, 5-Chloro-1,3-dimethyl-1H-indole-2-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-chloro-1,3-dimethylindole-2-carboxylic acid (CAS 152088-13-6) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 5-chloro-1,3-dimethylindole-2-carboxylic acid. InChIKey: YWHLWJBYLZEDNM-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 5-chloro-1,3-dimethylindole-2-carboxylic acid |
| InChIKey | YWHLWJBYLZEDNM-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C=C(C=C2)Cl)C)C(=O)O |
Computed by PubChem (NCBI)