Products 1522198-99-7
CAS 1522198-99-7 is the registry number for 2-(2,2,3,3-Tetramethylcyclopropyl)-oxazole-4-carbpxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole-4-carboxylic acid (CAS 1522198-99-7) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole-4-carboxylic acid. InChIKey: XOZCWIVGROBDTA-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 2-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | XOZCWIVGROBDTA-UHFFFAOYSA-N |
| SMILES | CC1(C(C1(C)C)C2=NC(=CO2)C(=O)O)C |
Computed by PubChem (NCBI)