CAS 1522380-26-2 appears in our catalog under these names: 4-Bromo-5-nitrothiazole, 95%, 4-Bromo-5-nitrothiazole, 97%, 4-BROMO-5-NITROTHIAZOLE, 99%, 99%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
4-bromo-5-nitro-1,3-thiazole (CAS 1522380-26-2) is a chemical compound with the molecular formula C3HBrN2O2S and a molecular weight of 209.02 g/mol. IUPAC name: 4-bromo-5-nitro-1,3-thiazole. InChIKey: HOVUSUQMGFTQKB-UHFFFAOYSA-N.
| Molecular formula | C3HBrN2O2S |
|---|---|
| Molecular weight | 209.02 g/mol |
| IUPAC name | 4-bromo-5-nitro-1,3-thiazole |
| InChIKey | HOVUSUQMGFTQKB-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(S1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)