CAS 1989672-78-7 appears in our catalog under these names: 3-Bromo-4-nitro-1,2-thiazole, 95%, 3-Bromo-4-nitro-1,2-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-bromo-4-nitro-1,2-thiazole (CAS 1989672-78-7) is a chemical compound with the molecular formula C3HBrN2O2S and a molecular weight of 209.02 g/mol. IUPAC name: 3-bromo-4-nitro-1,2-thiazole. InChIKey: URSKGLODXRZCTH-UHFFFAOYSA-N.
| Molecular formula | C3HBrN2O2S |
|---|---|
| Molecular weight | 209.02 g/mol |
| IUPAC name | 3-bromo-4-nitro-1,2-thiazole |
| InChIKey | URSKGLODXRZCTH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NS1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)