Products 41731-79-7
CAS 41731-79-7 is the registry number for 2-Bromo-4-nitrothiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-4-nitro-1,3-thiazole (CAS 41731-79-7) is a chemical compound with the molecular formula C3HBrN2O2S and a molecular weight of 209.02 g/mol. IUPAC name: 2-bromo-4-nitro-1,3-thiazole. InChIKey: KVRSJMFCNVKNQT-UHFFFAOYSA-N.
| Molecular formula | C3HBrN2O2S |
|---|---|
| Molecular weight | 209.02 g/mol |
| IUPAC name | 2-bromo-4-nitro-1,3-thiazole |
| InChIKey | KVRSJMFCNVKNQT-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)