CAS 1522380-30-8 appears in our catalog under these names: 5-Bromo-4-nitrothiazole, 97%, 5-Bromo-4-nitro-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5000mg.
5-bromo-4-nitro-1,3-thiazole (CAS 1522380-30-8) is a chemical compound with the molecular formula C3HBrN2O2S and a molecular weight of 209.02 g/mol. IUPAC name: 5-bromo-4-nitro-1,3-thiazole. InChIKey: VHWPCQORVLFXIH-UHFFFAOYSA-N.
| Molecular formula | C3HBrN2O2S |
|---|---|
| Molecular weight | 209.02 g/mol |
| IUPAC name | 5-bromo-4-nitro-1,3-thiazole |
| InChIKey | VHWPCQORVLFXIH-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(S1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)