CAS 152265-57-1 appears in our catalog under these names: 7–Bromophthalazin–1(2H)–one, 7-Bromophthalazin-1(2H)-one, 95%, 7-Bromophthalazin-1(2H)-one, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
7-bromo-2H-phthalazin-1-one (CAS 152265-57-1) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 7-bromo-2H-phthalazin-1-one. InChIKey: GGWROXJIYDRIMU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 7-bromo-2H-phthalazin-1-one |
| InChIKey | GGWROXJIYDRIMU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)NN=C2 |
Computed by PubChem (NCBI)