CAS 1523530-24-6 appears in our catalog under these names: Methyl (2r,4r)-2-methylpiperidine-4-carboxylate hydrochloride, 95%, 4-Piperidinecarboxylic acid, 2-methyl-, methyl ester, hydrochloride (1:1), (2R,4R)-, 97%, 97%, (2R,4R)-Methyl 2-methylpiperidine-4-carboxylate hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl (2R,4R)-2-methylpiperidine-4-carboxylate;hydrochloride (CAS 1523530-24-6) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2R,4R)-2-methylpiperidine-4-carboxylate;hydrochloride. InChIKey: UARIIFVOZSXRPR-ZJLYAJKPSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (2R,4R)-2-methylpiperidine-4-carboxylate;hydrochloride |
| InChIKey | UARIIFVOZSXRPR-ZJLYAJKPSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1)C(=O)OC.Cl |
Computed by PubChem (NCBI)