Products 2387560-52-1
CAS 2387560-52-1 appears in our catalog under these names: Methyl (2S,4S)-2-methylpiperidine-4-carboxylate hydrochloride, 97%, Methyl (2S,4S)-2-methylpiperidine-4-carboxylate hydrochloride, 95%, 95%, METHYL (2S,4S)-2-METHYLPIPERIDINE-4-CARBOXYLATE HYDROCHLORIDE, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Methyl (2S,4S)-2-methylpiperidine-4-carboxylate;hydrochloride (CAS 2387560-52-1) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2S,4S)-2-methylpiperidine-4-carboxylate;hydrochloride. InChIKey: UARIIFVOZSXRPR-LEUCUCNGSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (2S,4S)-2-methylpiperidine-4-carboxylate;hydrochloride |
| InChIKey | UARIIFVOZSXRPR-LEUCUCNGSA-N |
| SMILES | C[C@H]1C[C@H](CCN1)C(=O)OC.Cl |
Computed by PubChem (NCBI)