CAS 1523530-60-0 is the registry number for Methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Trans-methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate;hydrochloride (CAS 1523530-60-0) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate;hydrochloride. InChIKey: YNGIJCQPNBJXTP-GEMLJDPKSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate;hydrochloride |
| InChIKey | YNGIJCQPNBJXTP-GEMLJDPKSA-N |
| SMILES | CC1([C@@H](C[C@@H]1N)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)