CAS 2247088-07-7 appears in our catalog under these names: Methyl (1s,3r)-3-amino-2,2-dimethyl-cyclobutanecarboxylate hydrochloride, 95%, Methyl (1s,3r)-3-amino-2,2-dimethyl-cyclobutanecarboxylate hydrochloride, 97%, Methyl (1S,3R)-3-amino-2,2-dimethylcyclobutane-1-carboxylate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 10g, 5g, 50mg, 0,5g.
Trans-methyl (1S,3R)-3-amino-2,2-dimethylcyclobutane-1-carboxylate;hydrochloride (CAS 2247088-07-7) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-methyl (1S,3R)-3-amino-2,2-dimethylcyclobutane-1-carboxylate;hydrochloride. InChIKey: YNGIJCQPNBJXTP-KGZKBUQUSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-methyl (1S,3R)-3-amino-2,2-dimethylcyclobutane-1-carboxylate;hydrochloride |
| InChIKey | YNGIJCQPNBJXTP-KGZKBUQUSA-N |
| SMILES | CC1([C@H](C[C@H]1N)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)