Products 1523541-95-8
CAS 1523541-95-8 is the registry number for (2r,5s)-1,2,5-trimethylpiperazine oxalate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Oxalic acid;(2R,5S)-1,2,5-trimethylpiperazine (CAS 1523541-95-8) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: oxalic acid;(2R,5S)-1,2,5-trimethylpiperazine. InChIKey: NBBIBDQOZBEFCJ-UOERWJHTSA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | oxalic acid;(2R,5S)-1,2,5-trimethylpiperazine |
| InChIKey | NBBIBDQOZBEFCJ-UOERWJHTSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)