Products 1523571-15-4
CAS 1523571-15-4 appears in our catalog under these names: 1-Azaspiro[3.3]heptane hemioxalate 97%, 1-Azaspiro[3.3]heptanehemioxalate, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
Bis(1-azaspiro[3.3]heptane);oxalic acid (CAS 1523571-15-4) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: bis(1-azaspiro[3.3]heptane);oxalic acid. InChIKey: FTMKRJIGDQCVDH-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | bis(1-azaspiro[3.3]heptane);oxalic acid |
| InChIKey | FTMKRJIGDQCVDH-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CCN2.C1CC2(C1)CCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)